C6H9F2N — CID 138552264
(Z)-1,1-difluoro-N-methylpent-3-en-2-imine (PubChem CID 138552264) has the molecular formula C6H9F2N and a molecular weight of 133.14 g/mol. Its IUPAC name is (Z)-1,1-difluoro-N-methylpent-3-en-2-imine.
| Compound Name | (Z)-1,1-difluoro-N-methylpent-3-en-2-imine |
|---|---|
| PubChem CID | 138552264 |
| Molecular Formula | C6H9F2N |
| Molecular Weight | 133.14 g/mol |
| Exact Mass | 133.07 |
| IUPAC Name | (Z)-1,1-difluoro-N-methylpent-3-en-2-imine |
| SMILES | C/C=C\C(=N\C)C(F)F |
| InChI | InChI=1S/C6H9F2N/c1-3-4-5(9-2)6(7)8/h3-4,6H,1-2H3/b4-3-,9-5- |
| InChIKey | ILIKXYDOXKCZKB-YSXYLNKBSA-N |
| XLogP | 1.90 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 133.14 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|