C13H14F3NO2 — CID 162608381
(2S,7Z,9E)-2-amino-6-methylidene-9-(trifluoromethyl)undeca-7,9-dien-4-ynoic acid (PubChem CID 162608381) has the molecular formula C13H14F3NO2 and a molecular weight of 273.25 g/mol. Its IUPAC name is (2S,7Z,9E)-2-amino-6-methylidene-9-(trifluoromethyl)undeca-7,9-dien-4-ynoic acid.
| Compound Name | (2S,7Z,9E)-2-amino-6-methylidene-9-(trifluoromethyl)undeca-7,9-dien-4-ynoic acid |
|---|---|
| PubChem CID | 162608381 |
| Molecular Formula | C13H14F3NO2 |
| Molecular Weight | 273.25 g/mol |
| Exact Mass | 273.10 |
| IUPAC Name | (2S,7Z,9E)-2-amino-6-methylidene-9-(trifluoromethyl)undeca-7,9-dien-4-ynoic acid |
| SMILES | C=C(C#CC[C@H](N)C(=O)O)/C=C\C(=C/C)C(F)(F)F |
| InChI | InChI=1S/C13H14F3NO2/c1-3-10(13(14,15)16)8-7-9(2)5-4-6-11(17)12(18)19/h3,7-8,11H,2,6,17H2,1H3,(H,18,19)/b8-7-,10-3+/t11-/m0/s1 |
| InChIKey | OQBGBRQOAATRRY-XJLHFKKWSA-N |
| XLogP | 2.41 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.25 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|