About (2S)-2-aminohept-4-ynoic acid
(2S)-2-aminohept-4-ynoic acid (PubChem CID 129155198) has the molecular formula C7H11NO2
and a molecular weight of 141.17 g/mol. Its IUPAC name is (2S)-2-aminohept-4-ynoic acid.
Molecular Properties
| Compound Name | (2S)-2-aminohept-4-ynoic acid |
| PubChem CID | 129155198 |
| Molecular Formula | C7H11NO2 |
| Molecular Weight | 141.17 g/mol |
| Exact Mass | 141.08 |
| IUPAC Name | (2S)-2-aminohept-4-ynoic acid |
| SMILES | CCC#CC[C@H](N)C(=O)O |
| InChI | InChI=1S/C7H11NO2/c1-2-3-4-5-6(8)7(9)10/h6H,2,5,8H2,1H3,(H,9,10)/t6-/m0/s1 |
| InChIKey | JKEFFUAJUGJFKH-LURJTMIESA-N |
| XLogP | 0.20 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.17 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-aminohept-4-ynoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-aminohept-4-ynoic acid?
The IUPAC name of (2S)-2-aminohept-4-ynoic acid (CID 129155198) is (2S)-2-aminohept-4-ynoic acid.
What is the SMILES notation for (2S)-2-aminohept-4-ynoic acid?
The canonical SMILES for (2S)-2-aminohept-4-ynoic acid is CCC#CC[C@H](N)C(=O)O.
What is the InChIKey of (2S)-2-aminohept-4-ynoic acid?
The InChIKey is JKEFFUAJUGJFKH-LURJTMIESA-N. The full InChI is InChI=1S/C7H11NO2/c1-2-3-4-5-6(8)7(9)10/h6H,2,5,8H2,1H3,(H,9,10)/t6-/m0/s1.
What are the key properties of (2S)-2-aminohept-4-ynoic acid?
(2S)-2-aminohept-4-ynoic acid has a molecular weight of 141.17 g/mol, XLogP of 0.20, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-aminohept-4-ynoic acid is sourced from PubChem (CID 129155198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).