About 2-aminobutanoic acid;ethane
2-aminobutanoic acid;ethane (PubChem CID 90764297) has the molecular formula C6H15NO2
and a molecular weight of 133.19 g/mol. Its IUPAC name is 2-aminobutanoic acid;ethane.
Molecular Properties
| Compound Name | 2-aminobutanoic acid;ethane |
| PubChem CID | 90764297 |
| Molecular Formula | C6H15NO2 |
| Molecular Weight | 133.19 g/mol |
| Exact Mass | 133.11 |
| IUPAC Name | 2-aminobutanoic acid;ethane |
| SMILES | CC.CCC(N)C(=O)O |
| InChI | InChI=1S/C4H9NO2.C2H6/c1-2-3(5)4(6)7;1-2/h3H,2,5H2,1H3,(H,6,7);1-2H3 |
| InChIKey | ZYRUOGLEZKUAEI-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 133.19 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-aminobutanoic acid;ethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminobutanoic acid;ethane?
The IUPAC name of 2-aminobutanoic acid;ethane (CID 90764297) is 2-aminobutanoic acid;ethane.
What is the SMILES notation for 2-aminobutanoic acid;ethane?
The canonical SMILES for 2-aminobutanoic acid;ethane is CC.CCC(N)C(=O)O.
What is the InChIKey of 2-aminobutanoic acid;ethane?
The InChIKey is ZYRUOGLEZKUAEI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.C2H6/c1-2-3(5)4(6)7;1-2/h3H,2,5H2,1H3,(H,6,7);1-2H3.
What are the key properties of 2-aminobutanoic acid;ethane?
2-aminobutanoic acid;ethane has a molecular weight of 133.19 g/mol, XLogP of 0.83, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminobutanoic acid;ethane is sourced from PubChem (CID 90764297), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).