About aluminum 2-aminobutanoic acid
aluminum 2-aminobutanoic acid (PubChem CID 19792235) has the molecular formula C4H9AlNO2+3
and a molecular weight of 130.10 g/mol. Its IUPAC name is aluminum 2-aminobutanoic acid.
Molecular Properties
| Compound Name | aluminum 2-aminobutanoic acid |
| PubChem CID | 19792235 |
| Molecular Formula | C4H9AlNO2+3 |
| Molecular Weight | 130.10 g/mol |
| Exact Mass | 130.04 |
| IUPAC Name | aluminum 2-aminobutanoic acid |
| SMILES | CCC(N)C(=O)O.[Al+3] |
| InChI | InChI=1S/C4H9NO2.Al/c1-2-3(5)4(6)7;/h3H,2,5H2,1H3,(H,6,7);/q;+3 |
| InChIKey | FEQGEYOOQBDYHV-UHFFFAOYSA-N |
| XLogP | -0.57 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.10 |
| LogP ≤ 5 | -0.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze aluminum 2-aminobutanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of aluminum 2-aminobutanoic acid?
The IUPAC name of aluminum 2-aminobutanoic acid (CID 19792235) is aluminum 2-aminobutanoic acid.
What is the SMILES notation for aluminum 2-aminobutanoic acid?
The canonical SMILES for aluminum 2-aminobutanoic acid is CCC(N)C(=O)O.[Al+3].
What is the InChIKey of aluminum 2-aminobutanoic acid?
The InChIKey is FEQGEYOOQBDYHV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H9NO2.Al/c1-2-3(5)4(6)7;/h3H,2,5H2,1H3,(H,6,7);/q;+3.
What are the key properties of aluminum 2-aminobutanoic acid?
aluminum 2-aminobutanoic acid has a molecular weight of 130.10 g/mol, XLogP of -0.57, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for aluminum 2-aminobutanoic acid is sourced from PubChem (CID 19792235), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).