C8H15NO4 — CID 161129910
2-aminobutanoic acid;2-methylprop-2-enoic acid (PubChem CID 161129910) has the molecular formula C8H15NO4 and a molecular weight of 189.21 g/mol. Its IUPAC name is 2-aminobutanoic acid;2-methylprop-2-enoic acid.
| Compound Name | 2-aminobutanoic acid;2-methylprop-2-enoic acid |
|---|---|
| PubChem CID | 161129910 |
| Molecular Formula | C8H15NO4 |
| Molecular Weight | 189.21 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 2-aminobutanoic acid;2-methylprop-2-enoic acid |
| SMILES | C=C(C)C(=O)O.CCC(N)C(=O)O |
| InChI | InChI=1S/C4H9NO2.C4H6O2/c1-2-3(5)4(6)7;1-3(2)4(5)6/h3H,2,5H2,1H3,(H,6,7);1H2,2H3,(H,5,6) |
| InChIKey | UMAVHKHNVVHEDI-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|