C6H13NO4 — CID 87105922
acetic acid;(2R)-2-aminobutanoic acid (PubChem CID 87105922) has the molecular formula C6H13NO4 and a molecular weight of 163.17 g/mol. Its IUPAC name is acetic acid;(2R)-2-aminobutanoic acid.
| Compound Name | acetic acid;(2R)-2-aminobutanoic acid |
|---|---|
| PubChem CID | 87105922 |
| Molecular Formula | C6H13NO4 |
| Molecular Weight | 163.17 g/mol |
| Exact Mass | 163.08 |
| IUPAC Name | acetic acid;(2R)-2-aminobutanoic acid |
| SMILES | CC(=O)O.CC[C@@H](N)C(=O)O |
| InChI | InChI=1S/C4H9NO2.C2H4O2/c1-2-3(5)4(6)7;1-2(3)4/h3H,2,5H2,1H3,(H,6,7);1H3,(H,3,4)/t3-;/m1./s1 |
| InChIKey | NOCRJZLAQVDJMD-AENDTGMFSA-N |
| XLogP | -0.10 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 163.17 |
| LogP ≤ 5 | -0.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |