About 3-aminopentan-2-one;methane;pentan-3-imine
3-aminopentan-2-one;methane;pentan-3-imine (PubChem CID 162124306) has the molecular formula C12H30N2O
and a molecular weight of 218.38 g/mol. Its IUPAC name is 3-aminopentan-2-one;methane;pentan-3-imine.
Molecular Properties
| Compound Name | 3-aminopentan-2-one;methane;pentan-3-imine |
| PubChem CID | 162124306 |
| Molecular Formula | C12H30N2O |
| Molecular Weight | 218.38 g/mol |
| Exact Mass | 218.24 |
| IUPAC Name | 3-aminopentan-2-one;methane;pentan-3-imine |
| SMILES | C.C.CCC(N)C(C)=O.[H]N=C(CC)CC |
| InChI | InChI=1S/C5H11NO.C5H11N.2CH4/c1-3-5(6)4(2)7;1-3-5(6)4-2;;/h5H,3,6H2,1-2H3;6H,3-4H2,1-2H3;2*1H4 |
| InChIKey | ZHVAOCAGKWVJHI-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 66.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.38 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|
Analyze 3-aminopentan-2-one;methane;pentan-3-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-aminopentan-2-one;methane;pentan-3-imine?
The IUPAC name of 3-aminopentan-2-one;methane;pentan-3-imine (CID 162124306) is 3-aminopentan-2-one;methane;pentan-3-imine.
What is the SMILES notation for 3-aminopentan-2-one;methane;pentan-3-imine?
The canonical SMILES for 3-aminopentan-2-one;methane;pentan-3-imine is C.C.CCC(N)C(C)=O.[H]N=C(CC)CC.
What is the InChIKey of 3-aminopentan-2-one;methane;pentan-3-imine?
The InChIKey is ZHVAOCAGKWVJHI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H11NO.C5H11N.2CH4/c1-3-5(6)4(2)7;1-3-5(6)4-2;;/h5H,3,6H2,1-2H3;6H,3-4H2,1-2H3;2*1H4.
What are the key properties of 3-aminopentan-2-one;methane;pentan-3-imine?
3-aminopentan-2-one;methane;pentan-3-imine has a molecular weight of 218.38 g/mol, XLogP of 3.41, 4 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-aminopentan-2-one;methane;pentan-3-imine is sourced from PubChem (CID 162124306), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).