C13H29N3O4S2 — CID 160601879
(3R)-3-aminopentan-2-one;(3R)-3-amino-4-sulfanylbutan-2-one;methyl (2S)-2-amino-3-sulfanylpropanoate (PubChem CID 160601879) has the molecular formula C13H29N3O4S2 and a molecular weight of 355.53 g/mol. Its IUPAC name is (3R)-3-aminopentan-2-one;(3R)-3-amino-4-sulfanylbutan-2-one;methyl (2S)-2-amino-3-sulfanylpropanoate.
| Compound Name | (3R)-3-aminopentan-2-one;(3R)-3-amino-4-sulfanylbutan-2-one;methyl (2S)-2-amino-3-sulfanylpropanoate |
|---|---|
| PubChem CID | 160601879 |
| Molecular Formula | C13H29N3O4S2 |
| Molecular Weight | 355.53 g/mol |
| Exact Mass | 355.16 |
| IUPAC Name | (3R)-3-aminopentan-2-one;(3R)-3-amino-4-sulfanylbutan-2-one;methyl (2S)-2-amino-3-sulfanylpropanoate |
| SMILES | CC(=O)[C@@H](N)CS.CC[C@@H](N)C(C)=O.COC(=O)[C@H](N)CS |
| InChI | InChI=1S/C5H11NO.C4H9NO2S.C4H9NOS/c1-3-5(6)4(2)7;1-7-4(6)3(5)2-8;1-3(6)4(5)2-7/h5H,3,6H2,1-2H3;3,8H,2,5H2,1H3;4,7H,2,5H2,1H3/t5-;3-;4-/m110/s1 |
| InChIKey | REJNOIVOEIWEAO-JBAWHKGTSA-N |
| XLogP | -0.44 |
| TPSA | 138.50 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.53 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|