C6H11NO2S — CID 57340121
(2S)-2-amino-3-[(2R,3R)-3-methylthiiran-2-yl]propanoic acid (PubChem CID 57340121) has the molecular formula C6H11NO2S and a molecular weight of 161.23 g/mol. Its IUPAC name is (2S)-2-amino-3-[(2R,3R)-3-methylthiiran-2-yl]propanoic acid.
| Compound Name | (2S)-2-amino-3-[(2R,3R)-3-methylthiiran-2-yl]propanoic acid |
|---|---|
| PubChem CID | 57340121 |
| Molecular Formula | C6H11NO2S |
| Molecular Weight | 161.23 g/mol |
| Exact Mass | 161.05 |
| IUPAC Name | (2S)-2-amino-3-[(2R,3R)-3-methylthiiran-2-yl]propanoic acid |
| SMILES | C[C@H]1S[C@@H]1C[C@H](N)C(=O)O |
| InChI | InChI=1S/C6H11NO2S/c1-3-5(10-3)2-4(7)6(8)9/h3-5H,2,7H2,1H3,(H,8,9)/t3-,4+,5-/m1/s1 |
| InChIKey | KUYNDOOSKGGDRI-MROZADKFSA-N |
| XLogP | 0.29 |
| TPSA | 63.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 161.23 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|