C12H22F3N — CID 156717514
(1E)-N-methyl-N-propan-2-yl-2-(trifluoromethyl)buta-1,3-dien-1-amine;propane (PubChem CID 156717514) has the molecular formula C12H22F3N and a molecular weight of 237.31 g/mol. Its IUPAC name is (1E)-N-methyl-N-propan-2-yl-2-(trifluoromethyl)buta-1,3-dien-1-amine;propane.
| Compound Name | (1E)-N-methyl-N-propan-2-yl-2-(trifluoromethyl)buta-1,3-dien-1-amine;propane |
|---|---|
| PubChem CID | 156717514 |
| Molecular Formula | C12H22F3N |
| Molecular Weight | 237.31 g/mol |
| Exact Mass | 237.17 |
| IUPAC Name | (1E)-N-methyl-N-propan-2-yl-2-(trifluoromethyl)buta-1,3-dien-1-amine;propane |
| SMILES | C=C/C(=C\N(C)C(C)C)C(F)(F)F.CCC |
| InChI | InChI=1S/C9H14F3N.C3H8/c1-5-8(9(10,11)12)6-13(4)7(2)3;1-3-2/h5-7H,1H2,2-4H3;3H2,1-2H3/b8-6+; |
| InChIKey | LYEWSJPYDVUNRA-WVLIHFOGSA-N |
| XLogP | 4.38 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.31 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|