C8H11F4N — CID 155001350
(1E,3E)-N-ethyl-4-fluoro-N-methyl-2-(trifluoromethyl)buta-1,3-dien-1-amine (PubChem CID 155001350) has the molecular formula C8H11F4N and a molecular weight of 197.18 g/mol. Its IUPAC name is (1E,3E)-N-ethyl-4-fluoro-N-methyl-2-(trifluoromethyl)buta-1,3-dien-1-amine.
| Compound Name | (1E,3E)-N-ethyl-4-fluoro-N-methyl-2-(trifluoromethyl)buta-1,3-dien-1-amine |
|---|---|
| PubChem CID | 155001350 |
| Molecular Formula | C8H11F4N |
| Molecular Weight | 197.18 g/mol |
| Exact Mass | 197.08 |
| IUPAC Name | (1E,3E)-N-ethyl-4-fluoro-N-methyl-2-(trifluoromethyl)buta-1,3-dien-1-amine |
| SMILES | CCN(C)/C=C(\C=C\F)C(F)(F)F |
| InChI | InChI=1S/C8H11F4N/c1-3-13(2)6-7(4-5-9)8(10,11)12/h4-6H,3H2,1-2H3/b5-4+,7-6+ |
| InChIKey | HEHMYBXPNYSZFL-YTXTXJHMSA-N |
| XLogP | 2.87 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 197.18 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|