C28H40O3 — CID 138474615
[(3E,5E,8E,10E)-6,8-bis(ethenyl)-7,7-dimethyl-11-[(2-methylpropan-2-yl)oxy]trideca-1,3,5,8,10,12-hexaen-3-yl] 2,2-dimethylpropanoate (PubChem CID 138474615) has the molecular formula C28H40O3 and a molecular weight of 424.63 g/mol. Its IUPAC name is [(3E,5E,8E,10E)-6,8-bis(ethenyl)-7,7-dimethyl-11-[(2-methylpropan-2-yl)oxy]trideca-1,3,5,8,10,12-hexaen-3-yl] 2,2-dimethylpropanoate.
| Compound Name | [(3E,5E,8E,10E)-6,8-bis(ethenyl)-7,7-dimethyl-11-[(2-methylpropan-2-yl)oxy]trideca-1,3,5,8,10,12-hexaen-3-yl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 138474615 |
| Molecular Formula | C28H40O3 |
| Molecular Weight | 424.63 g/mol |
| Exact Mass | 424.30 |
| IUPAC Name | [(3E,5E,8E,10E)-6,8-bis(ethenyl)-7,7-dimethyl-11-[(2-methylpropan-2-yl)oxy]trideca-1,3,5,8,10,12-hexaen-3-yl] 2,2-dimethylpropanoate |
| SMILES | C=C/C(=C\C=C(/C=C)C(C)(C)/C(C=C)=C/C=C(\C=C)OC(C)(C)C)OC(=O)C(C)(C)C |
| InChI | InChI=1S/C28H40O3/c1-13-21(17-19-23(15-3)30-25(29)26(5,6)7)28(11,12)22(14-2)18-20-24(16-4)31-27(8,9)10/h13-20H,1-4H2,5-12H3/b21-17+,22-18+,23-19+,24-20+ |
| InChIKey | OFXDBSVGVVXGMU-OKNOEDMOSA-N |
| XLogP | 7.78 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.63 |
| LogP ≤ 5 | 7.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|