C25H32O — CID 166927220
(3Z,5E,8E,10E)-6,8-bis(ethenyl)-3,7,7-trimethyl-11-[(3E)-penta-1,3-dien-3-yl]oxytrideca-1,3,5,8,10,12-hexaene (PubChem CID 166927220) has the molecular formula C25H32O and a molecular weight of 348.53 g/mol. Its IUPAC name is (3Z,5E,8E,10E)-6,8-bis(ethenyl)-3,7,7-trimethyl-11-[(3E)-penta-1,3-dien-3-yl]oxytrideca-1,3,5,8,10,12-hexaene.
| Compound Name | (3Z,5E,8E,10E)-6,8-bis(ethenyl)-3,7,7-trimethyl-11-[(3E)-penta-1,3-dien-3-yl]oxytrideca-1,3,5,8,10,12-hexaene |
|---|---|
| PubChem CID | 166927220 |
| Molecular Formula | C25H32O |
| Molecular Weight | 348.53 g/mol |
| Exact Mass | 348.25 |
| IUPAC Name | (3Z,5E,8E,10E)-6,8-bis(ethenyl)-3,7,7-trimethyl-11-[(3E)-penta-1,3-dien-3-yl]oxytrideca-1,3,5,8,10,12-hexaene |
| SMILES | C=C/C(C)=C\C=C(/C=C)C(C)(C)/C(C=C)=C/C=C(\C=C)O/C(C=C)=C/C |
| InChI | InChI=1S/C25H32O/c1-10-20(7)16-17-21(11-2)25(8,9)22(12-3)18-19-24(15-6)26-23(13-4)14-5/h10-19H,1-4,6H2,5,7-9H3/b20-16-,21-17+,22-18+,23-14+,24-19+ |
| InChIKey | ZVOVVVMCYSVSLX-NYMIBBCGSA-N |
| XLogP | 7.55 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.53 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|