C16H26O — CID 91222189
3-(5,5-dimethylhexa-1,3-dien-3-yloxy)-5,5-dimethylhexa-1,3-diene (PubChem CID 91222189) has the molecular formula C16H26O and a molecular weight of 234.38 g/mol. Its IUPAC name is 3-(5,5-dimethylhexa-1,3-dien-3-yloxy)-5,5-dimethylhexa-1,3-diene.
| Compound Name | 3-(5,5-dimethylhexa-1,3-dien-3-yloxy)-5,5-dimethylhexa-1,3-diene |
|---|---|
| PubChem CID | 91222189 |
| Molecular Formula | C16H26O |
| Molecular Weight | 234.38 g/mol |
| Exact Mass | 234.20 |
| IUPAC Name | 3-(5,5-dimethylhexa-1,3-dien-3-yloxy)-5,5-dimethylhexa-1,3-diene |
| SMILES | C=CC(=CC(C)(C)C)OC(C=C)=CC(C)(C)C |
| InChI | InChI=1S/C16H26O/c1-9-13(11-15(3,4)5)17-14(10-2)12-16(6,7)8/h9-12H,1-2H2,3-8H3 |
| InChIKey | SCWZILVWVUUEFA-UHFFFAOYSA-N |
| XLogP | 5.24 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.38 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|