C9H12F2 — CID 134447442
(3E,5E)-7,7-difluoro-3,6-dimethylhepta-1,3,5-triene (PubChem CID 134447442) has the molecular formula C9H12F2 and a molecular weight of 158.19 g/mol. Its IUPAC name is (3E,5E)-7,7-difluoro-3,6-dimethylhepta-1,3,5-triene.
| Compound Name | (3E,5E)-7,7-difluoro-3,6-dimethylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 134447442 |
| Molecular Formula | C9H12F2 |
| Molecular Weight | 158.19 g/mol |
| Exact Mass | 158.09 |
| IUPAC Name | (3E,5E)-7,7-difluoro-3,6-dimethylhepta-1,3,5-triene |
| SMILES | C=C/C(C)=C/C=C(\C)C(F)F |
| InChI | InChI=1S/C9H12F2/c1-4-7(2)5-6-8(3)9(10)11/h4-6,9H,1H2,2-3H3/b7-5+,8-6+ |
| InChIKey | QGKQBTLYZIXMHH-KQQUZDAGSA-N |
| XLogP | 3.33 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 158.19 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|