C17H30O2 — CID 129173068
(3E,5E)-3-tert-butyl-10-(1-methoxyethoxy)deca-1,3,5-triene (PubChem CID 129173068) has the molecular formula C17H30O2 and a molecular weight of 266.42 g/mol. Its IUPAC name is (3E,5E)-3-tert-butyl-10-(1-methoxyethoxy)deca-1,3,5-triene.
| Compound Name | (3E,5E)-3-tert-butyl-10-(1-methoxyethoxy)deca-1,3,5-triene |
|---|---|
| PubChem CID | 129173068 |
| Molecular Formula | C17H30O2 |
| Molecular Weight | 266.42 g/mol |
| Exact Mass | 266.22 |
| IUPAC Name | (3E,5E)-3-tert-butyl-10-(1-methoxyethoxy)deca-1,3,5-triene |
| SMILES | C=C/C(=C\C=C\CCCCOC(C)OC)C(C)(C)C |
| InChI | InChI=1S/C17H30O2/c1-7-16(17(3,4)5)13-11-9-8-10-12-14-19-15(2)18-6/h7,9,11,13,15H,1,8,10,12,14H2,2-6H3/b11-9+,16-13+ |
| InChIKey | LCCZEZLUTQUKSN-BNUVGFPPSA-N |
| XLogP | 4.88 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.42 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|