C16H34O2 — CID 130241052
5,5-dimethyl-1-[1-(2-methylbutan-2-yloxy)ethoxy]heptane (PubChem CID 130241052) has the molecular formula C16H34O2 and a molecular weight of 258.45 g/mol. Its IUPAC name is 5,5-dimethyl-1-[1-(2-methylbutan-2-yloxy)ethoxy]heptane.
| Compound Name | 5,5-dimethyl-1-[1-(2-methylbutan-2-yloxy)ethoxy]heptane |
|---|---|
| PubChem CID | 130241052 |
| Molecular Formula | C16H34O2 |
| Molecular Weight | 258.45 g/mol |
| Exact Mass | 258.26 |
| IUPAC Name | 5,5-dimethyl-1-[1-(2-methylbutan-2-yloxy)ethoxy]heptane |
| SMILES | CCC(C)(C)CCCCOC(C)OC(C)(C)CC |
| InChI | InChI=1S/C16H34O2/c1-8-15(4,5)12-10-11-13-17-14(3)18-16(6,7)9-2/h14H,8-13H2,1-7H3 |
| InChIKey | WLNLUXYAZZQQLO-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.45 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|