C14H30O2 — CID 54255382
1-[1-(2,2-dimethylbutoxy)ethoxy]-2,2-dimethylbutane (PubChem CID 54255382) has the molecular formula C14H30O2 and a molecular weight of 230.39 g/mol. Its IUPAC name is 1-[1-(2,2-dimethylbutoxy)ethoxy]-2,2-dimethylbutane.
| Compound Name | 1-[1-(2,2-dimethylbutoxy)ethoxy]-2,2-dimethylbutane |
|---|---|
| PubChem CID | 54255382 |
| Molecular Formula | C14H30O2 |
| Molecular Weight | 230.39 g/mol |
| Exact Mass | 230.22 |
| IUPAC Name | 1-[1-(2,2-dimethylbutoxy)ethoxy]-2,2-dimethylbutane |
| SMILES | CCC(C)(C)COC(C)OCC(C)(C)CC |
| InChI | InChI=1S/C14H30O2/c1-8-13(4,5)10-15-12(3)16-11-14(6,7)9-2/h12H,8-11H2,1-7H3 |
| InChIKey | FZZQFYGODXDQOZ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.39 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|