C17H30O — CID 88565332
(3E,5E)-3-(1-butoxyethyl)-5-tert-butylhepta-1,3,5-triene (PubChem CID 88565332) has the molecular formula C17H30O and a molecular weight of 250.43 g/mol. Its IUPAC name is (3E,5E)-3-(1-butoxyethyl)-5-tert-butylhepta-1,3,5-triene.
| Compound Name | (3E,5E)-3-(1-butoxyethyl)-5-tert-butylhepta-1,3,5-triene |
|---|---|
| PubChem CID | 88565332 |
| Molecular Formula | C17H30O |
| Molecular Weight | 250.43 g/mol |
| Exact Mass | 250.23 |
| IUPAC Name | (3E,5E)-3-(1-butoxyethyl)-5-tert-butylhepta-1,3,5-triene |
| SMILES | C=C/C(=C\C(=C/C)C(C)(C)C)C(C)OCCCC |
| InChI | InChI=1S/C17H30O/c1-8-11-12-18-14(4)15(9-2)13-16(10-3)17(5,6)7/h9-10,13-14H,2,8,11-12H2,1,3-7H3/b15-13+,16-10+ |
| InChIKey | SNEVLRIWAHWLKS-SJKDQANVSA-N |
| XLogP | 5.30 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.43 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|