C30H52O2 — CID 88580495
(2E,4E)-4-tert-butyl-2-ethenyl-1-[(5E)-6-ethyl-5-ethylidene-2-methylidenenonoxy]-7,7-dimethylocta-2,4-dien-1-ol (PubChem CID 88580495) has the molecular formula C30H52O2 and a molecular weight of 444.74 g/mol. Its IUPAC name is (2E,4E)-4-tert-butyl-2-ethenyl-1-[(5E)-6-ethyl-5-ethylidene-2-methylidenenonoxy]-7,7-dimethylocta-2,4-dien-1-ol.
| Compound Name | (2E,4E)-4-tert-butyl-2-ethenyl-1-[(5E)-6-ethyl-5-ethylidene-2-methylidenenonoxy]-7,7-dimethylocta-2,4-dien-1-ol |
|---|---|
| PubChem CID | 88580495 |
| Molecular Formula | C30H52O2 |
| Molecular Weight | 444.74 g/mol |
| Exact Mass | 444.40 |
| IUPAC Name | (2E,4E)-4-tert-butyl-2-ethenyl-1-[(5E)-6-ethyl-5-ethylidene-2-methylidenenonoxy]-7,7-dimethylocta-2,4-dien-1-ol |
| SMILES | C=C/C(=C\C(=C/CC(C)(C)C)C(C)(C)C)C(O)OCC(=C)CC/C(=C\C)C(CC)CCC |
| InChI | InChI=1S/C30H52O2/c1-12-16-24(13-2)25(14-3)18-17-23(5)22-32-28(31)26(15-4)21-27(30(9,10)11)19-20-29(6,7)8/h14-15,19,21,24,28,31H,4-5,12-13,16-18,20,22H2,1-3,6-11H3/b25-14+,26-21+,27-19+ |
| InChIKey | SVPWMPSHYNKSLK-RACHAZQNSA-N |
| XLogP | 8.95 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.74 |
| LogP ≤ 5 | 8.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|