C15H26S — CID 138534065
(Z,4Z)-5-ethyl-7,7-dimethyl-4-prop-2-enylideneoct-2-ene-1-thiol (PubChem CID 138534065) has the molecular formula C15H26S and a molecular weight of 238.44 g/mol. Its IUPAC name is (Z,4Z)-5-ethyl-7,7-dimethyl-4-prop-2-enylideneoct-2-ene-1-thiol.
| Compound Name | (Z,4Z)-5-ethyl-7,7-dimethyl-4-prop-2-enylideneoct-2-ene-1-thiol |
|---|---|
| PubChem CID | 138534065 |
| Molecular Formula | C15H26S |
| Molecular Weight | 238.44 g/mol |
| Exact Mass | 238.18 |
| IUPAC Name | (Z,4Z)-5-ethyl-7,7-dimethyl-4-prop-2-enylideneoct-2-ene-1-thiol |
| SMILES | C=C/C=C(\C=C/CS)C(CC)CC(C)(C)C |
| InChI | InChI=1S/C15H26S/c1-6-9-14(10-8-11-16)13(7-2)12-15(3,4)5/h6,8-10,13,16H,1,7,11-12H2,2-5H3/b10-8-,14-9+ |
| InChIKey | ODRKWLHBNHDJKE-YYTLBARXSA-N |
| XLogP | 5.05 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.44 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|