C14H24 — CID 144893155
(Z,5Z)-6-methyl-5-prop-2-enylidenedec-3-ene (PubChem CID 144893155) has the molecular formula C14H24 and a molecular weight of 192.35 g/mol. Its IUPAC name is (Z,5Z)-6-methyl-5-prop-2-enylidenedec-3-ene.
| Compound Name | (Z,5Z)-6-methyl-5-prop-2-enylidenedec-3-ene |
|---|---|
| PubChem CID | 144893155 |
| Molecular Formula | C14H24 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.19 |
| IUPAC Name | (Z,5Z)-6-methyl-5-prop-2-enylidenedec-3-ene |
| SMILES | C=C/C=C(\C=C/CC)C(C)CCCC |
| InChI | InChI=1S/C14H24/c1-5-8-11-13(4)14(10-7-3)12-9-6-2/h7,9-10,12-13H,3,5-6,8,11H2,1-2,4H3/b12-9-,14-10+ |
| InChIKey | FOTGAFNIFWEGQY-SPEXVAAVSA-N |
| XLogP | 4.89 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|