C21H39F — CID 134316433
(Z,7Z,8R)-7-(2,2-dimethylbutylidene)-1-fluoro-2,3,8-trimethyldodec-5-ene (PubChem CID 134316433) has the molecular formula C21H39F and a molecular weight of 310.54 g/mol. Its IUPAC name is (Z,7Z,8R)-7-(2,2-dimethylbutylidene)-1-fluoro-2,3,8-trimethyldodec-5-ene.
| Compound Name | (Z,7Z,8R)-7-(2,2-dimethylbutylidene)-1-fluoro-2,3,8-trimethyldodec-5-ene |
|---|---|
| PubChem CID | 134316433 |
| Molecular Formula | C21H39F |
| Molecular Weight | 310.54 g/mol |
| Exact Mass | 310.30 |
| IUPAC Name | (Z,7Z,8R)-7-(2,2-dimethylbutylidene)-1-fluoro-2,3,8-trimethyldodec-5-ene |
| SMILES | CCCC[C@@H](C)C(/C=C\CC(C)C(C)CF)=C/C(C)(C)CC |
| InChI | InChI=1S/C21H39F/c1-8-10-12-18(4)20(15-21(6,7)9-2)14-11-13-17(3)19(5)16-22/h11,14-15,17-19H,8-10,12-13,16H2,1-7H3/b14-11-,20-15+/t17?,18-,19?/m1/s1 |
| InChIKey | ONSMZRGINWMJKL-OBEDBQITSA-N |
| XLogP | 7.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.54 |
| LogP ≤ 5 | 7.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|