C14H25NO — CID 167250897
(E,3Z)-1-amino-4-methyl-3-prop-2-enylidenedec-1-en-1-ol (PubChem CID 167250897) has the molecular formula C14H25NO and a molecular weight of 223.36 g/mol. Its IUPAC name is (E,3Z)-1-amino-4-methyl-3-prop-2-enylidenedec-1-en-1-ol.
| Compound Name | (E,3Z)-1-amino-4-methyl-3-prop-2-enylidenedec-1-en-1-ol |
|---|---|
| PubChem CID | 167250897 |
| Molecular Formula | C14H25NO |
| Molecular Weight | 223.36 g/mol |
| Exact Mass | 223.19 |
| IUPAC Name | (E,3Z)-1-amino-4-methyl-3-prop-2-enylidenedec-1-en-1-ol |
| SMILES | C=C/C=C(\C=C(/N)O)C(C)CCCCCC |
| InChI | InChI=1S/C14H25NO/c1-4-6-7-8-10-12(3)13(9-5-2)11-14(15)16/h5,9,11-12,16H,2,4,6-8,10,15H2,1,3H3/b13-9+,14-11+ |
| InChIKey | NETMJORVVARWFT-IJFRVEDASA-N |
| XLogP | 4.06 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.36 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|