About 4-methylnon-1-en-3-one
4-methylnon-1-en-3-one (PubChem CID 24974485) has the molecular formula C10H18O
and a molecular weight of 154.25 g/mol. Its IUPAC name is 4-methylnon-1-en-3-one.
Molecular Properties
| Compound Name | 4-methylnon-1-en-3-one |
| PubChem CID | 24974485 |
| Molecular Formula | C10H18O |
| Molecular Weight | 154.25 g/mol |
| Exact Mass | 154.14 |
| IUPAC Name | 4-methylnon-1-en-3-one |
| SMILES | C=CC(=O)C(C)CCCCC |
| InChI | InChI=1S/C10H18O/c1-4-6-7-8-9(3)10(11)5-2/h5,9H,2,4,6-8H2,1,3H3 |
| InChIKey | YTJOKVRUVYAXDM-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 154.25 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze 4-methylnon-1-en-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methylnon-1-en-3-one?
The IUPAC name of 4-methylnon-1-en-3-one (CID 24974485) is 4-methylnon-1-en-3-one.
What is the SMILES notation for 4-methylnon-1-en-3-one?
The canonical SMILES for 4-methylnon-1-en-3-one is C=CC(=O)C(C)CCCCC.
What is the InChIKey of 4-methylnon-1-en-3-one?
The InChIKey is YTJOKVRUVYAXDM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H18O/c1-4-6-7-8-9(3)10(11)5-2/h5,9H,2,4,6-8H2,1,3H3.
What are the key properties of 4-methylnon-1-en-3-one?
4-methylnon-1-en-3-one has a molecular weight of 154.25 g/mol, XLogP of 2.96, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methylnon-1-en-3-one is sourced from PubChem (CID 24974485), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).