About ethane;methanamine;(3S)-3-methyl-2-oxoheptanal
ethane;methanamine;(3S)-3-methyl-2-oxoheptanal (PubChem CID 143358738) has the molecular formula C11H25NO2
and a molecular weight of 203.33 g/mol. Its IUPAC name is ethane;methanamine;(3S)-3-methyl-2-oxoheptanal.
Molecular Properties
| Compound Name | ethane;methanamine;(3S)-3-methyl-2-oxoheptanal |
| PubChem CID | 143358738 |
| Molecular Formula | C11H25NO2 |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.19 |
| IUPAC Name | ethane;methanamine;(3S)-3-methyl-2-oxoheptanal |
| SMILES | CC.CCCC[C@H](C)C(=O)C=O.CN |
| InChI | InChI=1S/C8H14O2.C2H6.CH5N/c1-3-4-5-7(2)8(10)6-9;2*1-2/h6-7H,3-5H2,1-2H3;1-2H3;2H2,1H3/t7-;;/m0../s1 |
| InChIKey | YMSWJTJTESTQQA-KLXURFKVSA-N |
| XLogP | 2.18 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze ethane;methanamine;(3S)-3-methyl-2-oxoheptanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;methanamine;(3S)-3-methyl-2-oxoheptanal?
The IUPAC name of ethane;methanamine;(3S)-3-methyl-2-oxoheptanal (CID 143358738) is ethane;methanamine;(3S)-3-methyl-2-oxoheptanal.
What is the SMILES notation for ethane;methanamine;(3S)-3-methyl-2-oxoheptanal?
The canonical SMILES for ethane;methanamine;(3S)-3-methyl-2-oxoheptanal is CC.CCCC[C@H](C)C(=O)C=O.CN.
What is the InChIKey of ethane;methanamine;(3S)-3-methyl-2-oxoheptanal?
The InChIKey is YMSWJTJTESTQQA-KLXURFKVSA-N. The full InChI is InChI=1S/C8H14O2.C2H6.CH5N/c1-3-4-5-7(2)8(10)6-9;2*1-2/h6-7H,3-5H2,1-2H3;1-2H3;2H2,1H3/t7-;;/m0../s1.
What are the key properties of ethane;methanamine;(3S)-3-methyl-2-oxoheptanal?
ethane;methanamine;(3S)-3-methyl-2-oxoheptanal has a molecular weight of 203.33 g/mol, XLogP of 2.18, 5 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;methanamine;(3S)-3-methyl-2-oxoheptanal is sourced from PubChem (CID 143358738), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).