C14H21NO3 — CID 143315078
N-(1,2-dioxohept-6-yn-3-yl)-2-methylhexanamide (PubChem CID 143315078) has the molecular formula C14H21NO3 and a molecular weight of 251.33 g/mol. Its IUPAC name is N-(1,2-dioxohept-6-yn-3-yl)-2-methylhexanamide.
| Compound Name | N-(1,2-dioxohept-6-yn-3-yl)-2-methylhexanamide |
|---|---|
| PubChem CID | 143315078 |
| Molecular Formula | C14H21NO3 |
| Molecular Weight | 251.33 g/mol |
| Exact Mass | 251.15 |
| IUPAC Name | N-(1,2-dioxohept-6-yn-3-yl)-2-methylhexanamide |
| SMILES | C#CCCC(NC(=O)C(C)CCCC)C(=O)C=O |
| InChI | InChI=1S/C14H21NO3/c1-4-6-8-11(3)14(18)15-12(9-7-5-2)13(17)10-16/h2,10-12H,4,6-9H2,1,3H3,(H,15,18) |
| InChIKey | ZFAOITZDIZAECG-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.33 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|