About bis(2-methylhexanethioate);nickel(2+)
bis(2-methylhexanethioate);nickel(2+) (PubChem CID 21499168) has the molecular formula C14H26NiO2S2
and a molecular weight of 349.19 g/mol. Its IUPAC name is bis(2-methylhexanethioate);nickel(2+).
Molecular Properties
| Compound Name | bis(2-methylhexanethioate);nickel(2+) |
| PubChem CID | 21499168 |
| Molecular Formula | C14H26NiO2S2 |
| Molecular Weight | 349.19 g/mol |
| Exact Mass | 348.07 |
| IUPAC Name | bis(2-methylhexanethioate);nickel(2+) |
| SMILES | CCCCC(C)C(=O)[S-].CCCCC(C)C(=O)[S-].[Ni+2] |
| InChI | InChI=1S/2C7H14OS.Ni/c2*1-3-4-5-6(2)7(8)9;/h2*6H,3-5H2,1-2H3,(H,8,9);/q;;+2/p-2 |
| InChIKey | OWEWBRIDKRHOHE-UHFFFAOYSA-L |
| XLogP | 3.77 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.19 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze bis(2-methylhexanethioate);nickel(2+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-methylhexanethioate);nickel(2+)?
The IUPAC name of bis(2-methylhexanethioate);nickel(2+) (CID 21499168) is bis(2-methylhexanethioate);nickel(2+).
What is the SMILES notation for bis(2-methylhexanethioate);nickel(2+)?
The canonical SMILES for bis(2-methylhexanethioate);nickel(2+) is CCCCC(C)C(=O)[S-].CCCCC(C)C(=O)[S-].[Ni+2].
What is the InChIKey of bis(2-methylhexanethioate);nickel(2+)?
The InChIKey is OWEWBRIDKRHOHE-UHFFFAOYSA-L. The full InChI is InChI=1S/2C7H14OS.Ni/c2*1-3-4-5-6(2)7(8)9;/h2*6H,3-5H2,1-2H3,(H,8,9);/q;;+2/p-2.
What are the key properties of bis(2-methylhexanethioate);nickel(2+)?
bis(2-methylhexanethioate);nickel(2+) has a molecular weight of 349.19 g/mol, XLogP of 3.77, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-methylhexanethioate);nickel(2+) is sourced from PubChem (CID 21499168), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).