C12H19NO — CID 170070628
(Z,3E)-N,2-dimethyl-3-prop-2-enylidenehept-4-enamide (PubChem CID 170070628) has the molecular formula C12H19NO and a molecular weight of 193.29 g/mol. Its IUPAC name is (Z,3E)-N,2-dimethyl-3-prop-2-enylidenehept-4-enamide.
| Compound Name | (Z,3E)-N,2-dimethyl-3-prop-2-enylidenehept-4-enamide |
|---|---|
| PubChem CID | 170070628 |
| Molecular Formula | C12H19NO |
| Molecular Weight | 193.29 g/mol |
| Exact Mass | 193.15 |
| IUPAC Name | (Z,3E)-N,2-dimethyl-3-prop-2-enylidenehept-4-enamide |
| SMILES | C=C/C=C(\C=C/CC)C(C)C(=O)NC |
| InChI | InChI=1S/C12H19NO/c1-5-7-9-11(8-6-2)10(3)12(14)13-4/h6-10H,2,5H2,1,3-4H3,(H,13,14)/b9-7-,11-8+ |
| InChIKey | GJPLTXHGIDDUCY-BYSFRFKNSA-N |
| XLogP | 2.45 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 193.29 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|