About sodium 2-butoxypropanoate
sodium 2-butoxypropanoate (PubChem CID 141029680) has the molecular formula C7H13NaO3
and a molecular weight of 168.17 g/mol. Its IUPAC name is sodium 2-butoxypropanoate.
Molecular Properties
| Compound Name | sodium 2-butoxypropanoate |
| PubChem CID | 141029680 |
| Molecular Formula | C7H13NaO3 |
| Molecular Weight | 168.17 g/mol |
| Exact Mass | 168.08 |
| IUPAC Name | sodium 2-butoxypropanoate |
| SMILES | CCCCOC(C)C(=O)[O-].[Na+] |
| InChI | InChI=1S/C7H14O3.Na/c1-3-4-5-10-6(2)7(8)9;/h6H,3-5H2,1-2H3,(H,8,9);/q;+1/p-1 |
| InChIKey | APBHMCVSIHXGID-UHFFFAOYSA-M |
| XLogP | -3.05 |
| TPSA | 49.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.17 |
| LogP ≤ 5 | -3.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze sodium 2-butoxypropanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-butoxypropanoate?
The IUPAC name of sodium 2-butoxypropanoate (CID 141029680) is sodium 2-butoxypropanoate.
What is the SMILES notation for sodium 2-butoxypropanoate?
The canonical SMILES for sodium 2-butoxypropanoate is CCCCOC(C)C(=O)[O-].[Na+].
What is the InChIKey of sodium 2-butoxypropanoate?
The InChIKey is APBHMCVSIHXGID-UHFFFAOYSA-M. The full InChI is InChI=1S/C7H14O3.Na/c1-3-4-5-10-6(2)7(8)9;/h6H,3-5H2,1-2H3,(H,8,9);/q;+1/p-1.
What are the key properties of sodium 2-butoxypropanoate?
sodium 2-butoxypropanoate has a molecular weight of 168.17 g/mol, XLogP of -3.05, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-butoxypropanoate is sourced from PubChem (CID 141029680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).