C19H38O5 — CID 546234
1,1,3,3-tetrabutoxypropan-2-one (PubChem CID 546234) has the molecular formula C19H38O5 and a molecular weight of 346.51 g/mol. Its IUPAC name is 1,1,3,3-tetrabutoxypropan-2-one.
| Compound Name | 1,1,3,3-tetrabutoxypropan-2-one |
|---|---|
| PubChem CID | 546234 |
| Molecular Formula | C19H38O5 |
| Molecular Weight | 346.51 g/mol |
| Exact Mass | 346.27 |
| IUPAC Name | 1,1,3,3-tetrabutoxypropan-2-one |
| SMILES | CCCCOC(OCCCC)C(=O)C(OCCCC)OCCCC |
| InChI | InChI=1S/C19H38O5/c1-5-9-13-21-18(22-14-10-6-2)17(20)19(23-15-11-7-3)24-16-12-8-4/h18-19H,5-16H2,1-4H3 |
| InChIKey | YWNCVUCDRFNRGC-UHFFFAOYSA-N |
| XLogP | 4.47 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.51 |
| LogP ≤ 5 | 4.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|