C7H12O4 — CID 22235292
1-methoxyethoxymethyl prop-2-enoate (PubChem CID 22235292) has the molecular formula C7H12O4 and a molecular weight of 160.17 g/mol. Its IUPAC name is 1-methoxyethoxymethyl prop-2-enoate.
| Compound Name | 1-methoxyethoxymethyl prop-2-enoate |
|---|---|
| PubChem CID | 22235292 |
| Molecular Formula | C7H12O4 |
| Molecular Weight | 160.17 g/mol |
| Exact Mass | 160.07 |
| IUPAC Name | 1-methoxyethoxymethyl prop-2-enoate |
| SMILES | C=CC(=O)OCOC(C)OC |
| InChI | InChI=1S/C7H12O4/c1-4-7(8)11-5-10-6(2)9-3/h4,6H,1,5H2,2-3H3 |
| InChIKey | BSKAZWRREAGQJH-UHFFFAOYSA-N |
| XLogP | 0.68 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.17 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|