2-(1-methoxyethoxymethoxy)acetic acid

C6H12O5 — CID 87346668

IUPAC2-(1-methoxyethoxymethoxy)acetic acid
SMILESCOC(C)OCOCC(=O)O
InChIInChI=1S/C6H12O5/c1-5(9-2)11-4-10-3-6(7)8/h5H,3-4H2,1-2H3,(H,7,8)
InChIKeyCVWKQQVCMCGRQN-UHFFFAOYSA-N
MW164.16 g/mol
LogP0.05
Rot. Bonds6

About 2-(1-methoxyethoxymethoxy)acetic acid

2-(1-methoxyethoxymethoxy)acetic acid (PubChem CID 87346668) has the molecular formula C6H12O5 and a molecular weight of 164.16 g/mol. Its IUPAC name is 2-(1-methoxyethoxymethoxy)acetic acid.

Molecular Properties

Compound Name2-(1-methoxyethoxymethoxy)acetic acid
PubChem CID87346668
Molecular FormulaC6H12O5
Molecular Weight164.16 g/mol
Exact Mass164.07
IUPAC Name2-(1-methoxyethoxymethoxy)acetic acid
SMILESCOC(C)OCOCC(=O)O
InChIInChI=1S/C6H12O5/c1-5(9-2)11-4-10-3-6(7)8/h5H,3-4H2,1-2H3,(H,7,8)
InChIKeyCVWKQQVCMCGRQN-UHFFFAOYSA-N
XLogP0.05
TPSA64.99 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds6
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500164.16
LogP ≤ 50.05
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze 2-(1-methoxyethoxymethoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

2-(1-methoxyethoxy)acetic acid;zinc
CID 174204539
16-(1-methoxyethoxymethoxy)hexadecanoic acid
CID 19032988
2-(carboxymethoxymethoxy)-3-hydroxypropanoic acid
CID 71363690
1-methoxyethoxymethyl prop-2-enoate
CID 22235292
2-[hydroxy(methoxy)methoxy]acetic acid
CID 88732358
carboxymethoxy-dihydroxy-methoxyphosphanium
CID 46905067
2-[2-(1-aminoethoxy)ethoxy]acetic acid
CID 19037384
acetyl 2-(1-methoxyethoxy)acetate
CID 87664855
2-(2-butan-2-yloxyethoxy)acetic acid
CID 58779511
acetic acid;2-(dimethoxymethoxy)acetic acid
CID 88733225
2-(3-methyl-2-propan-2-ylbutoxy)acetic acid
CID 87847477
2-(carboxymethoxy)acetic acid;hydrochloride
CID 174705448

Frequently Asked Questions

What is the IUPAC name of 2-(1-methoxyethoxymethoxy)acetic acid?
The IUPAC name of 2-(1-methoxyethoxymethoxy)acetic acid (CID 87346668) is 2-(1-methoxyethoxymethoxy)acetic acid.
What is the SMILES notation for 2-(1-methoxyethoxymethoxy)acetic acid?
The canonical SMILES for 2-(1-methoxyethoxymethoxy)acetic acid is COC(C)OCOCC(=O)O.
What is the InChIKey of 2-(1-methoxyethoxymethoxy)acetic acid?
The InChIKey is CVWKQQVCMCGRQN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H12O5/c1-5(9-2)11-4-10-3-6(7)8/h5H,3-4H2,1-2H3,(H,7,8).
What are the key properties of 2-(1-methoxyethoxymethoxy)acetic acid?
2-(1-methoxyethoxymethoxy)acetic acid has a molecular weight of 164.16 g/mol, XLogP of 0.05, 6 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1-methoxyethoxymethoxy)acetic acid is sourced from PubChem (CID 87346668), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).