About acetic acid;2-(dimethoxymethoxy)acetic acid
acetic acid;2-(dimethoxymethoxy)acetic acid (PubChem CID 88733225) has the molecular formula C7H14O7
and a molecular weight of 210.18 g/mol. Its IUPAC name is acetic acid;2-(dimethoxymethoxy)acetic acid.
Molecular Properties
| Compound Name | acetic acid;2-(dimethoxymethoxy)acetic acid |
| PubChem CID | 88733225 |
| Molecular Formula | C7H14O7 |
| Molecular Weight | 210.18 g/mol |
| Exact Mass | 210.07 |
| IUPAC Name | acetic acid;2-(dimethoxymethoxy)acetic acid |
| SMILES | CC(=O)O.COC(OC)OCC(=O)O |
| InChI | InChI=1S/C5H10O5.C2H4O2/c1-8-5(9-2)10-3-4(6)7;1-2(3)4/h5H,3H2,1-2H3,(H,6,7);1H3,(H,3,4) |
| InChIKey | SIDXWQDKRRZFDC-UHFFFAOYSA-N |
| XLogP | -0.25 |
| TPSA | 102.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.18 |
| LogP ≤ 5 | -0.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|
Analyze acetic acid;2-(dimethoxymethoxy)acetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetic acid;2-(dimethoxymethoxy)acetic acid?
The IUPAC name of acetic acid;2-(dimethoxymethoxy)acetic acid (CID 88733225) is acetic acid;2-(dimethoxymethoxy)acetic acid.
What is the SMILES notation for acetic acid;2-(dimethoxymethoxy)acetic acid?
The canonical SMILES for acetic acid;2-(dimethoxymethoxy)acetic acid is CC(=O)O.COC(OC)OCC(=O)O.
What is the InChIKey of acetic acid;2-(dimethoxymethoxy)acetic acid?
The InChIKey is SIDXWQDKRRZFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5.C2H4O2/c1-8-5(9-2)10-3-4(6)7;1-2(3)4/h5H,3H2,1-2H3,(H,6,7);1H3,(H,3,4).
What are the key properties of acetic acid;2-(dimethoxymethoxy)acetic acid?
acetic acid;2-(dimethoxymethoxy)acetic acid has a molecular weight of 210.18 g/mol, XLogP of -0.25, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-(dimethoxymethoxy)acetic acid is sourced from PubChem (CID 88733225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).