acetic acid;2-(dimethoxymethoxy)acetic acid

C7H14O7 — CID 88733225

IUPACacetic acid;2-(dimethoxymethoxy)acetic acid
SMILESCC(=O)O.COC(OC)OCC(=O)O
InChIInChI=1S/C5H10O5.C2H4O2/c1-8-5(9-2)10-3-4(6)7;1-2(3)4/h5H,3H2,1-2H3,(H,6,7);1H3,(H,3,4)
InChIKeySIDXWQDKRRZFDC-UHFFFAOYSA-N
MW210.18 g/mol
LogP-0.25
Rot. Bonds5

About acetic acid;2-(dimethoxymethoxy)acetic acid

acetic acid;2-(dimethoxymethoxy)acetic acid (PubChem CID 88733225) has the molecular formula C7H14O7 and a molecular weight of 210.18 g/mol. Its IUPAC name is acetic acid;2-(dimethoxymethoxy)acetic acid.

Molecular Properties

Compound Nameacetic acid;2-(dimethoxymethoxy)acetic acid
PubChem CID88733225
Molecular FormulaC7H14O7
Molecular Weight210.18 g/mol
Exact Mass210.07
IUPAC Nameacetic acid;2-(dimethoxymethoxy)acetic acid
SMILESCC(=O)O.COC(OC)OCC(=O)O
InChIInChI=1S/C5H10O5.C2H4O2/c1-8-5(9-2)10-3-4(6)7;1-2(3)4/h5H,3H2,1-2H3,(H,6,7);1H3,(H,3,4)
InChIKeySIDXWQDKRRZFDC-UHFFFAOYSA-N
XLogP-0.25
TPSA102.29 Ų
H-Bond Donors2
H-Bond Acceptors5
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500210.18
LogP ≤ 5-0.25
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 105

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}

Analyze acetic acid;2-(dimethoxymethoxy)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

acetic acid;2-[hydroxy(methoxy)methoxy]acetic acid
CID 88732357
2-[hydroxy(methoxy)methoxy]acetic acid
CID 88732358
2-(1-methoxyethoxy)acetic acid;zinc
CID 174204539
carboxymethoxy-dihydroxy-methoxyphosphanium
CID 46905067
2-[1-(dimethylamino)propan-2-yloxy]acetic acid
CID 138038028
2-[(2R)-butan-2-yl]oxyacetic acid
CID 92979817
2-(1-hydroxypropan-2-yloxy)acetic acid
CID 23129856
2-(1-methoxyethoxymethoxy)acetic acid
CID 87346668
2-methoxyacetic acid;titanium
CID 174298740
2-methoxyacetic acid;silver
CID 158784523
2-heptan-4-yloxyacetic acid
CID 88738639
acetic acid;ruthenium
CID 175502908

Frequently Asked Questions

What is the IUPAC name of acetic acid;2-(dimethoxymethoxy)acetic acid?
The IUPAC name of acetic acid;2-(dimethoxymethoxy)acetic acid (CID 88733225) is acetic acid;2-(dimethoxymethoxy)acetic acid.
What is the SMILES notation for acetic acid;2-(dimethoxymethoxy)acetic acid?
The canonical SMILES for acetic acid;2-(dimethoxymethoxy)acetic acid is CC(=O)O.COC(OC)OCC(=O)O.
What is the InChIKey of acetic acid;2-(dimethoxymethoxy)acetic acid?
The InChIKey is SIDXWQDKRRZFDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10O5.C2H4O2/c1-8-5(9-2)10-3-4(6)7;1-2(3)4/h5H,3H2,1-2H3,(H,6,7);1H3,(H,3,4).
What are the key properties of acetic acid;2-(dimethoxymethoxy)acetic acid?
acetic acid;2-(dimethoxymethoxy)acetic acid has a molecular weight of 210.18 g/mol, XLogP of -0.25, 5 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for acetic acid;2-(dimethoxymethoxy)acetic acid is sourced from PubChem (CID 88733225), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).