C6H10N2O2 — CID 172679295
N,N-dimethylprop-2-enamide;isocyanic acid (PubChem CID 172679295) has the molecular formula C6H10N2O2 and a molecular weight of 142.16 g/mol. Its IUPAC name is N,N-dimethylprop-2-enamide;isocyanic acid.
| Compound Name | N,N-dimethylprop-2-enamide;isocyanic acid |
|---|---|
| PubChem CID | 172679295 |
| Molecular Formula | C6H10N2O2 |
| Molecular Weight | 142.16 g/mol |
| Exact Mass | 142.07 |
| IUPAC Name | N,N-dimethylprop-2-enamide;isocyanic acid |
| SMILES | C=CC(=O)N(C)C.N=C=O |
| InChI | InChI=1S/C5H9NO.CHNO/c1-4-5(7)6(2)3;2-1-3/h4H,1H2,2-3H3;2H |
| InChIKey | AEGMJKXUFSEAGS-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 61.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.16 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isocyanate', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|