C21H20O3 — CID 142826257
(3E,5E)-1-hydroxy-6-[hydroxy(diphenyl)methyl]octa-3,5,7-trien-2-one (PubChem CID 142826257) has the molecular formula C21H20O3 and a molecular weight of 320.39 g/mol. Its IUPAC name is (3E,5E)-1-hydroxy-6-[hydroxy(diphenyl)methyl]octa-3,5,7-trien-2-one.
| Compound Name | (3E,5E)-1-hydroxy-6-[hydroxy(diphenyl)methyl]octa-3,5,7-trien-2-one |
|---|---|
| PubChem CID | 142826257 |
| Molecular Formula | C21H20O3 |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | (3E,5E)-1-hydroxy-6-[hydroxy(diphenyl)methyl]octa-3,5,7-trien-2-one |
| SMILES | C=C/C(=C\C=C\C(=O)CO)C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H20O3/c1-2-17(14-9-15-20(23)16-22)21(24,18-10-5-3-6-11-18)19-12-7-4-8-13-19/h2-15,22,24H,1,16H2/b15-9+,17-14+ |
| InChIKey | JZDQYGAHPRLBKI-IZPHCAIHSA-N |
| XLogP | 3.15 |
| TPSA | 57.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|