C17H16O2 — CID 6268425
(E)-5-hydroxy-5,5-diphenylpent-3-en-2-one (PubChem CID 6268425) has the molecular formula C17H16O2 and a molecular weight of 252.31 g/mol. Its IUPAC name is (E)-5-hydroxy-5,5-diphenylpent-3-en-2-one.
| Compound Name | (E)-5-hydroxy-5,5-diphenylpent-3-en-2-one |
|---|---|
| PubChem CID | 6268425 |
| Molecular Formula | C17H16O2 |
| Molecular Weight | 252.31 g/mol |
| Exact Mass | 252.12 |
| IUPAC Name | (E)-5-hydroxy-5,5-diphenylpent-3-en-2-one |
| SMILES | CC(=O)/C=C/C(O)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C17H16O2/c1-14(18)12-13-17(19,15-8-4-2-5-9-15)16-10-6-3-7-11-16/h2-13,19H,1H3/b13-12+ |
| InChIKey | PWZRAFYSCJFGJW-OUKQBFOZSA-N |
| XLogP | 3.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.31 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|