C13H14O2 — CID 101114644
(3R)-6-deuterio-3-hydroxy-3-phenylhepta-4,5-dien-2-one (PubChem CID 101114644) has the molecular formula C13H14O2 and a molecular weight of 203.26 g/mol. Its IUPAC name is (3R)-6-deuterio-3-hydroxy-3-phenylhepta-4,5-dien-2-one.
| Compound Name | (3R)-6-deuterio-3-hydroxy-3-phenylhepta-4,5-dien-2-one |
|---|---|
| PubChem CID | 101114644 |
| Molecular Formula | C13H14O2 |
| Molecular Weight | 203.26 g/mol |
| Exact Mass | 203.11 |
| IUPAC Name | (3R)-6-deuterio-3-hydroxy-3-phenylhepta-4,5-dien-2-one |
| SMILES | [2H]C(C)=C=C[C@](O)(C(C)=O)c1ccccc1 |
| InChI | InChI=1S/C13H14O2/c1-3-4-10-13(15,11(2)14)12-8-6-5-7-9-12/h3,5-10,15H,1-2H3/t4?,13-/m0/s1/i3D |
| InChIKey | LNCSYEPWMHXOBY-TTZMKPFTSA-N |
| XLogP | 2.19 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.26 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |