C14H17NO — CID 139551714
(2E,4E)-N,N-dimethyl-5-(4-methylphenyl)penta-2,4-dienamide (PubChem CID 139551714) has the molecular formula C14H17NO and a molecular weight of 215.30 g/mol. Its IUPAC name is (2E,4E)-N,N-dimethyl-5-(4-methylphenyl)penta-2,4-dienamide.
| Compound Name | (2E,4E)-N,N-dimethyl-5-(4-methylphenyl)penta-2,4-dienamide |
|---|---|
| PubChem CID | 139551714 |
| Molecular Formula | C14H17NO |
| Molecular Weight | 215.30 g/mol |
| Exact Mass | 215.13 |
| IUPAC Name | (2E,4E)-N,N-dimethyl-5-(4-methylphenyl)penta-2,4-dienamide |
| SMILES | Cc1ccc(/C=C/C=C/C(=O)N(C)C)cc1 |
| InChI | InChI=1S/C14H17NO/c1-12-8-10-13(11-9-12)6-4-5-7-14(16)15(2)3/h4-11H,1-3H3/b6-4+,7-5+ |
| InChIKey | REHUFHVNXWZTAS-YDFGWWAZSA-N |
| XLogP | 2.65 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 215.30 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|