C17H18N2O2 — CID 134111994
(E)-N,N-dimethyl-3-[4-[(5-methyl-2-pyridinyl)oxy]phenyl]prop-2-enamide (PubChem CID 134111994) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is (E)-N,N-dimethyl-3-[4-[(5-methyl-2-pyridinyl)oxy]phenyl]prop-2-enamide.
| Compound Name | (E)-N,N-dimethyl-3-[4-[(5-methyl-2-pyridinyl)oxy]phenyl]prop-2-enamide |
|---|---|
| PubChem CID | 134111994 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | (E)-N,N-dimethyl-3-[4-[(5-methyl-2-pyridinyl)oxy]phenyl]prop-2-enamide |
| SMILES | Cc1ccc(Oc2ccc(/C=C/C(=O)N(C)C)cc2)nc1 |
| InChI | InChI=1S/C17H18N2O2/c1-13-4-10-16(18-12-13)21-15-8-5-14(6-9-15)7-11-17(20)19(2)3/h4-12H,1-3H3/b11-7+ |
| InChIKey | RZUBXQBBFOJJFR-YRNVUSSQSA-N |
| XLogP | 3.28 |
| TPSA | 42.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|