C10H17NO3S — CID 118592374
[(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate (PubChem CID 118592374) has the molecular formula C10H17NO3S and a molecular weight of 231.32 g/mol. Its IUPAC name is [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate.
| Compound Name | [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate |
|---|---|
| PubChem CID | 118592374 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate |
| SMILES | C=C/C=C\C(=C/CNC)COS(C)(=O)=O |
| InChI | InChI=1S/C10H17NO3S/c1-4-5-6-10(7-8-11-2)9-14-15(3,12)13/h4-7,11H,1,8-9H2,2-3H3/b6-5-,10-7+ |
| InChIKey | QCSPWVMIDYHJCN-ZZWPSLBBSA-N |
| XLogP | 0.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|