About [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate
[(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate (PubChem CID 118592374) has the molecular formula C10H17NO3S
and a molecular weight of 231.32 g/mol. Its IUPAC name is [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate.
Molecular Properties
| Compound Name | [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate |
| PubChem CID | 118592374 |
| Molecular Formula | C10H17NO3S |
| Molecular Weight | 231.32 g/mol |
| Exact Mass | 231.09 |
| IUPAC Name | [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate |
| SMILES | C=C/C=C\C(=C/CNC)COS(C)(=O)=O |
| InChI | InChI=1S/C10H17NO3S/c1-4-5-6-10(7-8-11-2)9-14-15(3,12)13/h4-7,11H,1,8-9H2,2-3H3/b6-5-,10-7+ |
| InChIKey | QCSPWVMIDYHJCN-ZZWPSLBBSA-N |
| XLogP | 0.85 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.32 |
| LogP ≤ 5 | 0.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate?
The IUPAC name of [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate (CID 118592374) is [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate.
What is the SMILES notation for [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate?
The canonical SMILES for [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate is C=C/C=C\C(=C/CNC)COS(C)(=O)=O.
What is the InChIKey of [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate?
The InChIKey is QCSPWVMIDYHJCN-ZZWPSLBBSA-N. The full InChI is InChI=1S/C10H17NO3S/c1-4-5-6-10(7-8-11-2)9-14-15(3,12)13/h4-7,11H,1,8-9H2,2-3H3/b6-5-,10-7+.
What are the key properties of [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate?
[(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate has a molecular weight of 231.32 g/mol, XLogP of 0.85, 7 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2E,3Z)-2-[2-(methylamino)ethylidene]hexa-3,5-dienyl] methanesulfonate is sourced from PubChem (CID 118592374), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).