C7H8F3NO3S — CID 155170687
(2E,4E)-N-(trifluoromethylsulfonyl)hexa-2,4-dienamide (PubChem CID 155170687) has the molecular formula C7H8F3NO3S and a molecular weight of 243.21 g/mol. Its IUPAC name is (2E,4E)-N-(trifluoromethylsulfonyl)hexa-2,4-dienamide.
| Compound Name | (2E,4E)-N-(trifluoromethylsulfonyl)hexa-2,4-dienamide |
|---|---|
| PubChem CID | 155170687 |
| Molecular Formula | C7H8F3NO3S |
| Molecular Weight | 243.21 g/mol |
| Exact Mass | 243.02 |
| IUPAC Name | (2E,4E)-N-(trifluoromethylsulfonyl)hexa-2,4-dienamide |
| SMILES | C/C=C/C=C/C(=O)NS(=O)(=O)C(F)(F)F |
| InChI | InChI=1S/C7H8F3NO3S/c1-2-3-4-5-6(12)11-15(13,14)7(8,9)10/h2-5H,1H3,(H,11,12)/b3-2+,5-4+ |
| InChIKey | QAIKBDGPPYIOEL-MQQKCMAXSA-N |
| XLogP | 1.08 |
| TPSA | 63.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.21 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|