C28H29N — CID 155027630
(2Z,5E,6Z)-N-ethenyl-8-(2-methylphenyl)-5-[2-(2-methylphenyl)prop-2-enylidene]nona-2,6,8-trien-4-imine (PubChem CID 155027630) has the molecular formula C28H29N and a molecular weight of 379.55 g/mol. Its IUPAC name is (2Z,5E,6Z)-N-ethenyl-8-(2-methylphenyl)-5-[2-(2-methylphenyl)prop-2-enylidene]nona-2,6,8-trien-4-imine.
| Compound Name | (2Z,5E,6Z)-N-ethenyl-8-(2-methylphenyl)-5-[2-(2-methylphenyl)prop-2-enylidene]nona-2,6,8-trien-4-imine |
|---|---|
| PubChem CID | 155027630 |
| Molecular Formula | C28H29N |
| Molecular Weight | 379.55 g/mol |
| Exact Mass | 379.23 |
| IUPAC Name | (2Z,5E,6Z)-N-ethenyl-8-(2-methylphenyl)-5-[2-(2-methylphenyl)prop-2-enylidene]nona-2,6,8-trien-4-imine |
| SMILES | C=C/N=C(\C=C/C)C(/C=C\C(=C)c1ccccc1C)=C/C(=C)c1ccccc1C |
| InChI | InChI=1S/C28H29N/c1-7-13-28(29-8-2)25(20-24(6)27-17-12-10-15-22(27)4)19-18-23(5)26-16-11-9-14-21(26)3/h7-20H,2,5-6H2,1,3-4H3/b13-7-,19-18-,25-20+,29-28+ |
| InChIKey | XMDUSVBNTRYUEI-FJBURJLDSA-N |
| XLogP | 7.67 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.55 |
| LogP ≤ 5 | 7.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|