About N-methyl-N-penta-1,3-dienylformamide
N-methyl-N-penta-1,3-dienylformamide (PubChem CID 123920122) has the molecular formula C7H11NO
and a molecular weight of 125.17 g/mol. Its IUPAC name is N-methyl-N-penta-1,3-dienylformamide.
Molecular Properties
| Compound Name | N-methyl-N-penta-1,3-dienylformamide |
| PubChem CID | 123920122 |
| Molecular Formula | C7H11NO |
| Molecular Weight | 125.17 g/mol |
| Exact Mass | 125.08 |
| IUPAC Name | N-methyl-N-penta-1,3-dienylformamide |
| SMILES | CC=CC=CN(C)C=O |
| InChI | InChI=1S/C7H11NO/c1-3-4-5-6-8(2)7-9/h3-7H,1-2H3 |
| InChIKey | RLTSCGWZONKXJF-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 125.17 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze N-methyl-N-penta-1,3-dienylformamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-methyl-N-penta-1,3-dienylformamide?
The IUPAC name of N-methyl-N-penta-1,3-dienylformamide (CID 123920122) is N-methyl-N-penta-1,3-dienylformamide.
What is the SMILES notation for N-methyl-N-penta-1,3-dienylformamide?
The canonical SMILES for N-methyl-N-penta-1,3-dienylformamide is CC=CC=CN(C)C=O.
What is the InChIKey of N-methyl-N-penta-1,3-dienylformamide?
The InChIKey is RLTSCGWZONKXJF-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H11NO/c1-3-4-5-6-8(2)7-9/h3-7H,1-2H3.
What are the key properties of N-methyl-N-penta-1,3-dienylformamide?
N-methyl-N-penta-1,3-dienylformamide has a molecular weight of 125.17 g/mol, XLogP of 1.16, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-methyl-N-penta-1,3-dienylformamide is sourced from PubChem (CID 123920122), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).