C10H19NO2S — CID 142228722
N-[dihydroxy-[(3E,5Z)-7-methylocta-1,3,5-trien-4-yl]-λ4-sulfanyl]methanamine (PubChem CID 142228722) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is N-[dihydroxy-[(3E,5Z)-7-methylocta-1,3,5-trien-4-yl]-λ4-sulfanyl]methanamine.
| Compound Name | N-[dihydroxy-[(3E,5Z)-7-methylocta-1,3,5-trien-4-yl]-λ4-sulfanyl]methanamine |
|---|---|
| PubChem CID | 142228722 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | N-[dihydroxy-[(3E,5Z)-7-methylocta-1,3,5-trien-4-yl]-λ4-sulfanyl]methanamine |
| SMILES | C=C/C=C(\C=C/C(C)C)S(O)(O)NC |
| InChI | InChI=1S/C10H19NO2S/c1-5-6-10(8-7-9(2)3)14(12,13)11-4/h5-9,11-13H,1H2,2-4H3/b8-7-,10-6+ |
| InChIKey | MVTFIAKIUARBOW-SDHBEMGISA-N |
| XLogP | 3.15 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|