C17H22 — CID 156737958
1-[(2Z)-2-ethenyl-5-methylhexa-2,4-dienyl]-3,5-dimethylbenzene (PubChem CID 156737958) has the molecular formula C17H22 and a molecular weight of 226.36 g/mol. Its IUPAC name is 1-[(2Z)-2-ethenyl-5-methylhexa-2,4-dienyl]-3,5-dimethylbenzene.
| Compound Name | 1-[(2Z)-2-ethenyl-5-methylhexa-2,4-dienyl]-3,5-dimethylbenzene |
|---|---|
| PubChem CID | 156737958 |
| Molecular Formula | C17H22 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.17 |
| IUPAC Name | 1-[(2Z)-2-ethenyl-5-methylhexa-2,4-dienyl]-3,5-dimethylbenzene |
| SMILES | C=C/C(=C\C=C(C)C)Cc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C17H22/c1-6-16(8-7-13(2)3)12-17-10-14(4)9-15(5)11-17/h6-11H,1,12H2,2-5H3/b16-8+ |
| InChIKey | STJFPUDDSXUFNT-LZYBPNLTSA-N |
| XLogP | 4.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|