C18H28 — CID 143985958
ethane;3-[(2Z)-2-ethenyl-5-methylhexa-2,4-dienyl]-1-methylcyclohexa-1,3-diene (PubChem CID 143985958) has the molecular formula C18H28 and a molecular weight of 244.42 g/mol. Its IUPAC name is ethane;3-[(2Z)-2-ethenyl-5-methylhexa-2,4-dienyl]-1-methylcyclohexa-1,3-diene.
| Compound Name | ethane;3-[(2Z)-2-ethenyl-5-methylhexa-2,4-dienyl]-1-methylcyclohexa-1,3-diene |
|---|---|
| PubChem CID | 143985958 |
| Molecular Formula | C18H28 |
| Molecular Weight | 244.42 g/mol |
| Exact Mass | 244.22 |
| IUPAC Name | ethane;3-[(2Z)-2-ethenyl-5-methylhexa-2,4-dienyl]-1-methylcyclohexa-1,3-diene |
| SMILES | C=C/C(=C\C=C(C)C)CC1=CCCC(C)=C1.CC |
| InChI | InChI=1S/C16H22.C2H6/c1-5-15(10-9-13(2)3)12-16-8-6-7-14(4)11-16;1-2/h5,8-11H,1,6-7,12H2,2-4H3;1-2H3/b15-10+; |
| InChIKey | OMIAMBSXHVFHOV-GYVLLFFHSA-N |
| XLogP | 6.15 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.42 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|