C14H21N — CID 103527856
N-[(3,5-dimethylphenyl)methyl]-3-methylbut-2-en-1-amine (PubChem CID 103527856) has the molecular formula C14H21N and a molecular weight of 203.33 g/mol. Its IUPAC name is N-[(3,5-dimethylphenyl)methyl]-3-methylbut-2-en-1-amine.
| Compound Name | N-[(3,5-dimethylphenyl)methyl]-3-methylbut-2-en-1-amine |
|---|---|
| PubChem CID | 103527856 |
| Molecular Formula | C14H21N |
| Molecular Weight | 203.33 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | N-[(3,5-dimethylphenyl)methyl]-3-methylbut-2-en-1-amine |
| SMILES | CC(C)=CCNCc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C14H21N/c1-11(2)5-6-15-10-14-8-12(3)7-13(4)9-14/h5,7-9,15H,6,10H2,1-4H3 |
| InChIKey | HPGDWJGFXFBCDV-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|