C13H17NO2 — CID 103239916
(Z)-2-methyl-4-[(3-methylphenyl)methylamino]but-2-enoic acid (PubChem CID 103239916) has the molecular formula C13H17NO2 and a molecular weight of 219.28 g/mol. Its IUPAC name is (Z)-2-methyl-4-[(3-methylphenyl)methylamino]but-2-enoic acid.
| Compound Name | (Z)-2-methyl-4-[(3-methylphenyl)methylamino]but-2-enoic acid |
|---|---|
| PubChem CID | 103239916 |
| Molecular Formula | C13H17NO2 |
| Molecular Weight | 219.28 g/mol |
| Exact Mass | 219.13 |
| IUPAC Name | (Z)-2-methyl-4-[(3-methylphenyl)methylamino]but-2-enoic acid |
| SMILES | C/C(=C/CNCc1cccc(C)c1)C(=O)O |
| InChI | InChI=1S/C13H17NO2/c1-10-4-3-5-12(8-10)9-14-7-6-11(2)13(15)16/h3-6,8,14H,7,9H2,1-2H3,(H,15,16)/b11-6- |
| InChIKey | MQCFAXUIIXLYHT-WDZFZDKYSA-N |
| XLogP | 2.12 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.28 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|